C11H19N — CID 572962
4a-methyl-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-amine (PubChem CID 572962) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 4a-methyl-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-amine.
| Compound Name | 4a-methyl-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 572962 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4a-methyl-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-amine |
| SMILES | CC12C=CC(N)CC1CCCC2 |
| InChI | InChI=1S/C11H19N/c1-11-6-3-2-4-9(11)8-10(12)5-7-11/h5,7,9-10H,2-4,6,8,12H2,1H3 |
| InChIKey | IAQJHTQLRTUUKN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|