C20H27NO3S — CID 57296362
ethyl (2S)-3-[3-(5-methyl-2,3-dihydro-1H-inden-2-yl)propanoyl]-1-sulfanylpyrrolidine-2-carboxylate (PubChem CID 57296362) has the molecular formula C20H27NO3S and a molecular weight of 361.51 g/mol. Its IUPAC name is ethyl (2S)-3-[3-(5-methyl-2,3-dihydro-1H-inden-2-yl)propanoyl]-1-sulfanylpyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S)-3-[3-(5-methyl-2,3-dihydro-1H-inden-2-yl)propanoyl]-1-sulfanylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57296362 |
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | ethyl (2S)-3-[3-(5-methyl-2,3-dihydro-1H-inden-2-yl)propanoyl]-1-sulfanylpyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C(=O)CCC2Cc3ccc(C)cc3C2)CCN1S |
| InChI | InChI=1S/C20H27NO3S/c1-3-24-20(23)19-17(8-9-21(19)25)18(22)7-5-14-11-15-6-4-13(2)10-16(15)12-14/h4,6,10,14,17,19,25H,3,5,7-9,11-12H2,1-2H3/t14?,17?,19-/m0/s1 |
| InChIKey | MFURBPRHIBDJAQ-YVNUBYTISA-N |
| XLogP | 3.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|