C16H10N4S2 — CID 57296577
2-phenyl-5-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazole (PubChem CID 57296577) has the molecular formula C16H10N4S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 2-phenyl-5-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-phenyl-5-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 57296577 |
| Molecular Formula | C16H10N4S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-phenyl-5-(5-phenyl-1,3,4-thiadiazol-2-yl)-1,3,4-thiadiazole |
| SMILES | c1ccc(-c2nnc(-c3nnc(-c4ccccc4)s3)s2)cc1 |
| InChI | InChI=1S/C16H10N4S2/c1-3-7-11(8-4-1)13-17-19-15(21-13)16-20-18-14(22-16)12-9-5-2-6-10-12/h1-10H |
| InChIKey | CXLGJZCYHJAKNZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |