C17H17F3O3S — CID 57296968
1-(2-methoxyethylsulfonyl)-2-(4-methylphenyl)-4-(trifluoromethyl)benzene (PubChem CID 57296968) has the molecular formula C17H17F3O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is 1-(2-methoxyethylsulfonyl)-2-(4-methylphenyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(2-methoxyethylsulfonyl)-2-(4-methylphenyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 57296968 |
| Molecular Formula | C17H17F3O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-(2-methoxyethylsulfonyl)-2-(4-methylphenyl)-4-(trifluoromethyl)benzene |
| SMILES | COCCS(=O)(=O)c1ccc(C(F)(F)F)cc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17F3O3S/c1-12-3-5-13(6-4-12)15-11-14(17(18,19)20)7-8-16(15)24(21,22)10-9-23-2/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | UNDVPPCAAXKWBK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |