About 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol
5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol (PubChem CID 57297498) has the molecular formula C15H10N4O2
and a molecular weight of 278.27 g/mol. Its IUPAC name is 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol.
Molecular Properties
| Compound Name | 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol |
| PubChem CID | 57297498 |
| Molecular Formula | C15H10N4O2 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol |
| SMILES | Oc1cc2cc(Oc3ncnc4ncccc34)ccc2[nH]1 |
| InChI | InChI=1S/C15H10N4O2/c20-13-7-9-6-10(3-4-12(9)19-13)21-15-11-2-1-5-16-14(11)17-8-18-15/h1-8,19-20H |
| InChIKey | HHGFNXAKHWTDMI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol?
The IUPAC name of 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol (CID 57297498) is 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol.
What is the SMILES notation for 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol?
The canonical SMILES for 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol is Oc1cc2cc(Oc3ncnc4ncccc34)ccc2[nH]1.
What is the InChIKey of 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol?
The InChIKey is HHGFNXAKHWTDMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N4O2/c20-13-7-9-6-10(3-4-12(9)19-13)21-15-11-2-1-5-16-14(11)17-8-18-15/h1-8,19-20H.
What are the key properties of 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol?
5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol has a molecular weight of 278.27 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrido[2,3-d]pyrimidin-4-yloxy-1H-indol-2-ol is sourced from PubChem (CID 57297498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).