C25H44O5 — CID 57297878
ethyl 7-[(1R,5R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethylidene]-5-hydroxycyclopentyl]heptanoate (PubChem CID 57297878) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is ethyl 7-[(1R,5R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethylidene]-5-hydroxycyclopentyl]heptanoate.
| Compound Name | ethyl 7-[(1R,5R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethylidene]-5-hydroxycyclopentyl]heptanoate |
|---|---|
| PubChem CID | 57297878 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | ethyl 7-[(1R,5R)-2-[2-(2-hexan-2-yl-1,3-dioxolan-2-yl)ethylidene]-5-hydroxycyclopentyl]heptanoate |
| SMILES | CCCCC(C)C1(CC=C2CC[C@@H](O)[C@@H]2CCCCCCC(=O)OCC)OCCO1 |
| InChI | InChI=1S/C25H44O5/c1-4-6-11-20(3)25(29-18-19-30-25)17-16-21-14-15-23(26)22(21)12-9-7-8-10-13-24(27)28-5-2/h16,20,22-23,26H,4-15,17-19H2,1-3H3/t20?,22-,23-/m1/s1 |
| InChIKey | JVTPSWALBUDIKB-JHRSTNGLSA-N |
| XLogP | 5.55 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|