C20H31NO5Si — CID 57297996
methyl (2S,3R)-2-(4-hydroxyphenyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate (PubChem CID 57297996) has the molecular formula C20H31NO5Si and a molecular weight of 393.56 g/mol. Its IUPAC name is methyl (2S,3R)-2-(4-hydroxyphenyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate.
| Compound Name | methyl (2S,3R)-2-(4-hydroxyphenyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 57297996 |
| Molecular Formula | C20H31NO5Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | methyl (2S,3R)-2-(4-hydroxyphenyl)-4-oxo-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C20H31NO5Si/c1-12(2)27(13(3)4,14(5)6)26-18-17(15-8-10-16(22)11-9-15)21(19(18)23)20(24)25-7/h8-14,17-18,22H,1-7H3/t17-,18+/m0/s1 |
| InChIKey | OTPSSSYQPLGWRA-ZWKOTPCHSA-N |
| XLogP | 4.60 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|