About (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate
(1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate (PubChem CID 57297999) has the molecular formula C25H35F3O2
and a molecular weight of 424.55 g/mol. Its IUPAC name is (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate |
| PubChem CID | 57297999 |
| Molecular Formula | C25H35F3O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate |
| SMILES | CCCCCC1(COC(=O)C2(c3cc(F)c(F)c(F)c3)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C25H35F3O2/c1-2-3-6-11-24(12-7-4-8-13-24)18-30-23(29)25(14-9-5-10-15-25)19-16-20(26)22(28)21(27)17-19/h16-17H,2-15,18H2,1H3 |
| InChIKey | SXOPOWOFLXVDQU-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The IUPAC name of (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate (CID 57297999) is (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate.
What is the SMILES notation for (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The canonical SMILES for (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate is CCCCCC1(COC(=O)C2(c3cc(F)c(F)c(F)c3)CCCCC2)CCCCC1.
What is the InChIKey of (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
The InChIKey is SXOPOWOFLXVDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35F3O2/c1-2-3-6-11-24(12-7-4-8-13-24)18-30-23(29)25(14-9-5-10-15-25)19-16-20(26)22(28)21(27)17-19/h16-17H,2-15,18H2,1H3.
What are the key properties of (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate?
(1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate has a molecular weight of 424.55 g/mol, XLogP of 7.38, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pentylcyclohexyl)methyl 1-(3,4,5-trifluorophenyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 57297999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).