C19H30O6 — CID 57298027
methyl (1'R,2'R,3'aS,6'aR)-2'-butanoyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate (PubChem CID 57298027) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is methyl (1'R,2'R,3'aS,6'aR)-2'-butanoyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate.
| Compound Name | methyl (1'R,2'R,3'aS,6'aR)-2'-butanoyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 57298027 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | methyl (1'R,2'R,3'aS,6'aR)-2'-butanoyloxy-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-carboxylate |
| SMILES | CCCC(=O)O[C@@H]1C[C@H]2CC3(C[C@H]2[C@H]1C(=O)OC)OCC(C)(C)CO3 |
| InChI | InChI=1S/C19H30O6/c1-5-6-15(20)25-14-7-12-8-19(23-10-18(2,3)11-24-19)9-13(12)16(14)17(21)22-4/h12-14,16H,5-11H2,1-4H3/t12-,13+,14+,16+/m0/s1 |
| InChIKey | MANOQXIURZFCAP-DSJMHWKBSA-N |
| XLogP | 2.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |