About 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole
2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 57298035) has the molecular formula C6H6N2OS
and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole |
| PubChem CID | 57298035 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | c1csc(C2=NCCO2)n1 |
| InChI | InChI=1S/C6H6N2OS/c1-3-9-5(7-1)6-8-2-4-10-6/h2,4H,1,3H2 |
| InChIKey | UKOHAQRLZCURNZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole (CID 57298035) is 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole is c1csc(C2=NCCO2)n1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole?
The InChIKey is UKOHAQRLZCURNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2OS/c1-3-9-5(7-1)6-8-2-4-10-6/h2,4H,1,3H2.
What are the key properties of 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole?
2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole has a molecular weight of 154.19 g/mol, XLogP of 0.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 57298035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).