C20H21FNO5+ — CID 57298085
(2R)-4-(3-fluorophenyl)-4-hydroxy-2-methyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57298085) has the molecular formula C20H21FNO5+ and a molecular weight of 374.39 g/mol. Its IUPAC name is (2R)-4-(3-fluorophenyl)-4-hydroxy-2-methyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-4-(3-fluorophenyl)-4-hydroxy-2-methyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57298085 |
| Molecular Formula | C20H21FNO5+ |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (2R)-4-(3-fluorophenyl)-4-hydroxy-2-methyl-1-phenylmethoxycarbonylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CC(O)(c2cccc(F)c2)C[N+]1(C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H20FNO5/c1-14-11-20(26,16-8-5-9-17(21)10-16)13-22(14,18(23)24)19(25)27-12-15-6-3-2-4-7-15/h2-10,14,26H,11-13H2,1H3/p+1/t14-,20?,22?/m1/s1 |
| InChIKey | PQTWPBPQNVEJJM-FEEUCNAYSA-O |
| XLogP | 3.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|