C17H18F3NO5 — CID 57298262
(5R)-5-(methoxymethyl)-3-[6-(4,4,4-trifluorobutoxy)-1-benzofuran-3-yl]-1,3-oxazolidin-2-one (PubChem CID 57298262) has the molecular formula C17H18F3NO5 and a molecular weight of 373.33 g/mol. Its IUPAC name is (5R)-5-(methoxymethyl)-3-[6-(4,4,4-trifluorobutoxy)-1-benzofuran-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(methoxymethyl)-3-[6-(4,4,4-trifluorobutoxy)-1-benzofuran-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 57298262 |
| Molecular Formula | C17H18F3NO5 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (5R)-5-(methoxymethyl)-3-[6-(4,4,4-trifluorobutoxy)-1-benzofuran-3-yl]-1,3-oxazolidin-2-one |
| SMILES | COC[C@H]1CN(c2coc3cc(OCCCC(F)(F)F)ccc23)C(=O)O1 |
| InChI | InChI=1S/C17H18F3NO5/c1-23-9-12-8-21(16(22)26-12)14-10-25-15-7-11(3-4-13(14)15)24-6-2-5-17(18,19)20/h3-4,7,10,12H,2,5-6,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | FEVVKOGNERNVOW-GFCCVEGCSA-N |
| XLogP | 4.13 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|