C19H25BrO3 — CID 57298759
(7R,8R,9S,10R,13S,14S,16R)-16-bromo-7-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 57298759) has the molecular formula C19H25BrO3 and a molecular weight of 381.31 g/mol. Its IUPAC name is (7R,8R,9S,10R,13S,14S,16R)-16-bromo-7-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7R,8R,9S,10R,13S,14S,16R)-16-bromo-7-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 57298759 |
| Molecular Formula | C19H25BrO3 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (7R,8R,9S,10R,13S,14S,16R)-16-bromo-7-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CCC(=O)C=C1C[C@@H](O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@H](Br)C[C@@H]12 |
| InChI | InChI=1S/C19H25BrO3/c1-18-5-3-11(21)7-10(18)8-15(22)16-12(18)4-6-19(2)13(16)9-14(20)17(19)23/h7,12-16,22H,3-6,8-9H2,1-2H3/t12-,13-,14+,15+,16+,18-,19-/m0/s1 |
| InChIKey | IIHQBJUCMIYAEV-DQPZPLTKSA-N |
| XLogP | 3.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|