C39H67N7O4 — CID 57298997
(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methyl 2-[[4-tert-butyl-6-[[2-[(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-2-oxoethylidene]amino]-1,3,5-triazin-2-yl]imino]acetate (PubChem CID 57298997) has the molecular formula C39H67N7O4 and a molecular weight of 698.01 g/mol. Its IUPAC name is (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methyl 2-[[4-tert-butyl-6-[[2-[(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-2-oxoethylidene]amino]-1,3,5-triazin-2-yl]imino]acetate.
| Compound Name | (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methyl 2-[[4-tert-butyl-6-[[2-[(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-2-oxoethylidene]amino]-1,3,5-triazin-2-yl]imino]acetate |
|---|---|
| PubChem CID | 57298997 |
| Molecular Formula | C39H67N7O4 |
| Molecular Weight | 698.01 g/mol |
| Exact Mass | 697.53 |
| IUPAC Name | (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methyl 2-[[4-tert-butyl-6-[[2-[(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl)methoxy]-2-oxoethylidene]amino]-1,3,5-triazin-2-yl]imino]acetate |
| SMILES | CCCCN1C(C)(C)CC(COC(=O)C=Nc2nc(N=CC(=O)OCC3CC(C)(C)N(CCCC)C(C)(C)C3)nc(C(C)(C)C)n2)CC1(C)C |
| InChI | InChI=1S/C39H67N7O4/c1-14-16-18-45-36(6,7)20-28(21-37(45,8)9)26-49-30(47)24-40-33-42-32(35(3,4)5)43-34(44-33)41-25-31(48)50-27-29-22-38(10,11)46(19-17-15-2)39(12,13)23-29/h24-25,28-29H,14-23,26-27H2,1-13H3 |
| InChIKey | OMJXWXXJNMEKJJ-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 122.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.01 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|