About 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid
3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid (PubChem CID 57299164) has the molecular formula C14H12N2O5
and a molecular weight of 288.26 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 57299164 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid |
| SMILES | COC(=O)CC1(C(=O)O)C=C(c2cccc(C#N)c2)NO1 |
| InChI | InChI=1S/C14H12N2O5/c1-20-12(17)7-14(13(18)19)6-11(16-21-14)10-4-2-3-9(5-10)8-15/h2-6,16H,7H2,1H3,(H,18,19) |
| InChIKey | GUMZDQGYQKDUKG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid (CID 57299164) is 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid is COC(=O)CC1(C(=O)O)C=C(c2cccc(C#N)c2)NO1.
What is the InChIKey of 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid?
The InChIKey is GUMZDQGYQKDUKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O5/c1-20-12(17)7-14(13(18)19)6-11(16-21-14)10-4-2-3-9(5-10)8-15/h2-6,16H,7H2,1H3,(H,18,19).
What are the key properties of 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid?
3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid has a molecular weight of 288.26 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyanophenyl)-5-(2-methoxy-2-oxoethyl)-2H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 57299164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).