About 2-hydroxyethyl 2-formylpent-4-enoate
2-hydroxyethyl 2-formylpent-4-enoate (PubChem CID 57299471) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-hydroxyethyl 2-formylpent-4-enoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-formylpent-4-enoate |
| PubChem CID | 57299471 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-hydroxyethyl 2-formylpent-4-enoate |
| SMILES | C=CCC(C=O)C(=O)OCCO |
| InChI | InChI=1S/C8H12O4/c1-2-3-7(6-10)8(11)12-5-4-9/h2,6-7,9H,1,3-5H2 |
| InChIKey | KHNKKEYQFMVRQB-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-formylpent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-formylpent-4-enoate?
The IUPAC name of 2-hydroxyethyl 2-formylpent-4-enoate (CID 57299471) is 2-hydroxyethyl 2-formylpent-4-enoate.
What is the SMILES notation for 2-hydroxyethyl 2-formylpent-4-enoate?
The canonical SMILES for 2-hydroxyethyl 2-formylpent-4-enoate is C=CCC(C=O)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-formylpent-4-enoate?
The InChIKey is KHNKKEYQFMVRQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-2-3-7(6-10)8(11)12-5-4-9/h2,6-7,9H,1,3-5H2.
What are the key properties of 2-hydroxyethyl 2-formylpent-4-enoate?
2-hydroxyethyl 2-formylpent-4-enoate has a molecular weight of 172.18 g/mol, XLogP of -0.09, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-formylpent-4-enoate is sourced from PubChem (CID 57299471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).