C18H19NO5S — CID 57300277
(3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-4-ylamino) 4-methylbenzenesulfonate (PubChem CID 57300277) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is (3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-4-ylamino) 4-methylbenzenesulfonate.
| Compound Name | (3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-4-ylamino) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57300277 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | (3,6,7,8-tetrahydro-2H-furo[2,3-g]chromen-4-ylamino) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)ONc2c3c(cc4c2OCCC4)OCC3)cc1 |
| InChI | InChI=1S/C18H19NO5S/c1-12-4-6-14(7-5-12)25(20,21)24-19-17-15-8-10-22-16(15)11-13-3-2-9-23-18(13)17/h4-7,11,19H,2-3,8-10H2,1H3 |
| InChIKey | REVLRVHDAZTGBG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|