About 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate
2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate (PubChem CID 57300435) has the molecular formula C18H18FNO5
and a molecular weight of 347.34 g/mol. Its IUPAC name is 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate.
Molecular Properties
| Compound Name | 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate |
| PubChem CID | 57300435 |
| Molecular Formula | C18H18FNO5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate |
| SMILES | COC(=O)C(=O)OC(N)CC(Oc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H18FNO5/c1-23-17(21)18(22)25-16(20)11-15(12-6-3-2-4-7-12)24-14-9-5-8-13(19)10-14/h2-10,15-16H,11,20H2,1H3 |
| InChIKey | MSCIBXWPDZDLFU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate?
The IUPAC name of 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate (CID 57300435) is 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate.
What is the SMILES notation for 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate?
The canonical SMILES for 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate is COC(=O)C(=O)OC(N)CC(Oc1cccc(F)c1)c1ccccc1.
What is the InChIKey of 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate?
The InChIKey is MSCIBXWPDZDLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18FNO5/c1-23-17(21)18(22)25-16(20)11-15(12-6-3-2-4-7-12)24-14-9-5-8-13(19)10-14/h2-10,15-16H,11,20H2,1H3.
What are the key properties of 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate?
2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate has a molecular weight of 347.34 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[1-amino-3-(3-fluorophenoxy)-3-phenylpropyl] 1-O-methyl oxalate is sourced from PubChem (CID 57300435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).