About 4-morpholin-4-ylfuro[3,2-c]pyridine
4-morpholin-4-ylfuro[3,2-c]pyridine (PubChem CID 57300664) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-morpholin-4-ylfuro[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-morpholin-4-ylfuro[3,2-c]pyridine |
| PubChem CID | 57300664 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-morpholin-4-ylfuro[3,2-c]pyridine |
| SMILES | c1cc2occc2c(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H12N2O2/c1-3-12-11(9-2-6-15-10(1)9)13-4-7-14-8-5-13/h1-3,6H,4-5,7-8H2 |
| InChIKey | JDXRSZNJVVCVLB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-morpholin-4-ylfuro[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-morpholin-4-ylfuro[3,2-c]pyridine?
The IUPAC name of 4-morpholin-4-ylfuro[3,2-c]pyridine (CID 57300664) is 4-morpholin-4-ylfuro[3,2-c]pyridine.
What is the SMILES notation for 4-morpholin-4-ylfuro[3,2-c]pyridine?
The canonical SMILES for 4-morpholin-4-ylfuro[3,2-c]pyridine is c1cc2occc2c(N2CCOCC2)n1.
What is the InChIKey of 4-morpholin-4-ylfuro[3,2-c]pyridine?
The InChIKey is JDXRSZNJVVCVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-3-12-11(9-2-6-15-10(1)9)13-4-7-14-8-5-13/h1-3,6H,4-5,7-8H2.
What are the key properties of 4-morpholin-4-ylfuro[3,2-c]pyridine?
4-morpholin-4-ylfuro[3,2-c]pyridine has a molecular weight of 204.23 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-4-ylfuro[3,2-c]pyridine is sourced from PubChem (CID 57300664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).