C19H14F6O2 — CID 57301024
1,3-bis[2-methyl-4-(trifluoromethyl)phenyl]propane-1,3-dione (PubChem CID 57301024) has the molecular formula C19H14F6O2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 1,3-bis[2-methyl-4-(trifluoromethyl)phenyl]propane-1,3-dione.
| Compound Name | 1,3-bis[2-methyl-4-(trifluoromethyl)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 57301024 |
| Molecular Formula | C19H14F6O2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1,3-bis[2-methyl-4-(trifluoromethyl)phenyl]propane-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)ccc1C(=O)CC(=O)c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C19H14F6O2/c1-10-7-12(18(20,21)22)3-5-14(10)16(26)9-17(27)15-6-4-13(8-11(15)2)19(23,24)25/h3-8H,9H2,1-2H3 |
| InChIKey | AIXMNGXDFCKPLS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|