About 9-(6-chloropurin-9-yl)purine-2,6-diamine
9-(6-chloropurin-9-yl)purine-2,6-diamine (PubChem CID 57301033) has the molecular formula C10H7ClN10
and a molecular weight of 302.69 g/mol. Its IUPAC name is 9-(6-chloropurin-9-yl)purine-2,6-diamine.
Molecular Properties
| Compound Name | 9-(6-chloropurin-9-yl)purine-2,6-diamine |
| PubChem CID | 57301033 |
| Molecular Formula | C10H7ClN10 |
| Molecular Weight | 302.69 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 9-(6-chloropurin-9-yl)purine-2,6-diamine |
| SMILES | Nc1nc(N)c2ncn(-n3cnc4c(Cl)ncnc43)c2n1 |
| InChI | InChI=1S/C10H7ClN10/c11-6-4-8(15-1-14-6)20(2-16-4)21-3-17-5-7(12)18-10(13)19-9(5)21/h1-3H,(H4,12,13,18,19) |
| InChIKey | RHPBOHGMFIBRAX-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 139.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.69 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 9-(6-chloropurin-9-yl)purine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(6-chloropurin-9-yl)purine-2,6-diamine?
The IUPAC name of 9-(6-chloropurin-9-yl)purine-2,6-diamine (CID 57301033) is 9-(6-chloropurin-9-yl)purine-2,6-diamine.
What is the SMILES notation for 9-(6-chloropurin-9-yl)purine-2,6-diamine?
The canonical SMILES for 9-(6-chloropurin-9-yl)purine-2,6-diamine is Nc1nc(N)c2ncn(-n3cnc4c(Cl)ncnc43)c2n1.
What is the InChIKey of 9-(6-chloropurin-9-yl)purine-2,6-diamine?
The InChIKey is RHPBOHGMFIBRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN10/c11-6-4-8(15-1-14-6)20(2-16-4)21-3-17-5-7(12)18-10(13)19-9(5)21/h1-3H,(H4,12,13,18,19).
What are the key properties of 9-(6-chloropurin-9-yl)purine-2,6-diamine?
9-(6-chloropurin-9-yl)purine-2,6-diamine has a molecular weight of 302.69 g/mol, XLogP of 0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(6-chloropurin-9-yl)purine-2,6-diamine is sourced from PubChem (CID 57301033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).