C13H27NO — CID 57301157
4-(2,2,4,4-tetramethylpentan-3-yl)morpholine (PubChem CID 57301157) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 4-(2,2,4,4-tetramethylpentan-3-yl)morpholine.
| Compound Name | 4-(2,2,4,4-tetramethylpentan-3-yl)morpholine |
|---|---|
| PubChem CID | 57301157 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 4-(2,2,4,4-tetramethylpentan-3-yl)morpholine |
| SMILES | CC(C)(C)C(N1CCOCC1)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-12(2,3)11(13(4,5)6)14-7-9-15-10-8-14/h11H,7-10H2,1-6H3 |
| InChIKey | UHYLOEKAACWMIE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |