About 2-(diethylamino)ethyl 2-oxopropanoate
2-(diethylamino)ethyl 2-oxopropanoate (PubChem CID 57301214) has the molecular formula C9H17NO3
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-oxopropanoate |
| PubChem CID | 57301214 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-(diethylamino)ethyl 2-oxopropanoate |
| SMILES | CCN(CC)CCOC(=O)C(C)=O |
| InChI | InChI=1S/C9H17NO3/c1-4-10(5-2)6-7-13-9(12)8(3)11/h4-7H2,1-3H3 |
| InChIKey | WJIDNVZAQJPWKW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-oxopropanoate?
The IUPAC name of 2-(diethylamino)ethyl 2-oxopropanoate (CID 57301214) is 2-(diethylamino)ethyl 2-oxopropanoate.
What is the SMILES notation for 2-(diethylamino)ethyl 2-oxopropanoate?
The canonical SMILES for 2-(diethylamino)ethyl 2-oxopropanoate is CCN(CC)CCOC(=O)C(C)=O.
What is the InChIKey of 2-(diethylamino)ethyl 2-oxopropanoate?
The InChIKey is WJIDNVZAQJPWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-4-10(5-2)6-7-13-9(12)8(3)11/h4-7H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl 2-oxopropanoate?
2-(diethylamino)ethyl 2-oxopropanoate has a molecular weight of 187.24 g/mol, XLogP of 0.46, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-oxopropanoate is sourced from PubChem (CID 57301214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).