About [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate
[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate (PubChem CID 57301568) has the molecular formula C15H14Cl2N2O5
and a molecular weight of 373.19 g/mol. Its IUPAC name is [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate.
Molecular Properties
| Compound Name | [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate |
| PubChem CID | 57301568 |
| Molecular Formula | C15H14Cl2N2O5 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)ONC1CC1C(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O5/c1-3-7(2)15(21)24-18-12-4-9(12)14(20)8-5-13(19(22)23)11(17)6-10(8)16/h5-6,9,12,18H,2-4H2,1H3 |
| InChIKey | OKXQLBPQCHTSHV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate?
The IUPAC name of [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate (CID 57301568) is [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate.
What is the SMILES notation for [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate?
The canonical SMILES for [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate is C=C(CC)C(=O)ONC1CC1C(=O)c1cc([N+](=O)[O-])c(Cl)cc1Cl.
What is the InChIKey of [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate?
The InChIKey is OKXQLBPQCHTSHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2N2O5/c1-3-7(2)15(21)24-18-12-4-9(12)14(20)8-5-13(19(22)23)11(17)6-10(8)16/h5-6,9,12,18H,2-4H2,1H3.
What are the key properties of [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate?
[[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate has a molecular weight of 373.19 g/mol, XLogP of 3.49, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(2,4-dichloro-5-nitrobenzoyl)cyclopropyl]amino] 2-methylidenebutanoate is sourced from PubChem (CID 57301568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).