About 2-(cyclopropylmethyl)-2,3-dihydrothiophene
2-(cyclopropylmethyl)-2,3-dihydrothiophene (PubChem CID 57301880) has the molecular formula C8H12S
and a molecular weight of 140.25 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2-(cyclopropylmethyl)-2,3-dihydrothiophene |
| PubChem CID | 57301880 |
| Molecular Formula | C8H12S |
| Molecular Weight | 140.25 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2-(cyclopropylmethyl)-2,3-dihydrothiophene |
| SMILES | C1=CSC(CC2CC2)C1 |
| InChI | InChI=1S/C8H12S/c1-2-8(9-5-1)6-7-3-4-7/h1,5,7-8H,2-4,6H2 |
| InChIKey | OUGPTCNFYNIQCE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.25 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(cyclopropylmethyl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethyl)-2,3-dihydrothiophene?
The IUPAC name of 2-(cyclopropylmethyl)-2,3-dihydrothiophene (CID 57301880) is 2-(cyclopropylmethyl)-2,3-dihydrothiophene.
What is the SMILES notation for 2-(cyclopropylmethyl)-2,3-dihydrothiophene?
The canonical SMILES for 2-(cyclopropylmethyl)-2,3-dihydrothiophene is C1=CSC(CC2CC2)C1.
What is the InChIKey of 2-(cyclopropylmethyl)-2,3-dihydrothiophene?
The InChIKey is OUGPTCNFYNIQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S/c1-2-8(9-5-1)6-7-3-4-7/h1,5,7-8H,2-4,6H2.
What are the key properties of 2-(cyclopropylmethyl)-2,3-dihydrothiophene?
2-(cyclopropylmethyl)-2,3-dihydrothiophene has a molecular weight of 140.25 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethyl)-2,3-dihydrothiophene is sourced from PubChem (CID 57301880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).