C25H33N3O2 — CID 57302315
[1-[4-(2-aminoethoxyamino)-4-phenylbut-3-enyl]piperidin-4-yl]-(3-methylphenyl)methanone (PubChem CID 57302315) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is [1-[4-(2-aminoethoxyamino)-4-phenylbut-3-enyl]piperidin-4-yl]-(3-methylphenyl)methanone.
| Compound Name | [1-[4-(2-aminoethoxyamino)-4-phenylbut-3-enyl]piperidin-4-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 57302315 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | [1-[4-(2-aminoethoxyamino)-4-phenylbut-3-enyl]piperidin-4-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)C2CCN(CCC=C(NOCCN)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-20-7-5-10-23(19-20)25(29)22-12-16-28(17-13-22)15-6-11-24(27-30-18-14-26)21-8-3-2-4-9-21/h2-5,7-11,19,22,27H,6,12-18,26H2,1H3 |
| InChIKey | UVUUMMRSZRKOKR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|