About 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene
6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene (PubChem CID 57302463) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene.
Molecular Properties
| Compound Name | 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene |
| PubChem CID | 57302463 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene |
| SMILES | CCOC(C)=CCC1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C15H26O/c1-6-16-13(3)9-10-14-12(2)8-7-11-15(14,4)5/h8-9,14H,6-7,10-11H2,1-5H3 |
| InChIKey | FDNHZLRARAAAMX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene?
The IUPAC name of 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene (CID 57302463) is 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene.
What is the SMILES notation for 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene?
The canonical SMILES for 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene is CCOC(C)=CCC1C(C)=CCCC1(C)C.
What is the InChIKey of 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene?
The InChIKey is FDNHZLRARAAAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O/c1-6-16-13(3)9-10-14-12(2)8-7-11-15(14,4)5/h8-9,14H,6-7,10-11H2,1-5H3.
What are the key properties of 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene?
6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene has a molecular weight of 222.37 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-ethoxybut-2-enyl)-1,5,5-trimethylcyclohexene is sourced from PubChem (CID 57302463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).