About [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid
[2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid (PubChem CID 57302754) has the molecular formula C15H17O7P
and a molecular weight of 340.27 g/mol. Its IUPAC name is [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid.
Molecular Properties
| Compound Name | [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid |
| PubChem CID | 57302754 |
| Molecular Formula | C15H17O7P |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid |
| SMILES | CC(c1ccc(O)cc1)C(O)(O)c1c(O)cccc1P(=O)(O)O |
| InChI | InChI=1S/C15H17O7P/c1-9(10-5-7-11(16)8-6-10)15(18,19)14-12(17)3-2-4-13(14)23(20,21)22/h2-9,16-19H,1H3,(H2,20,21,22) |
| InChIKey | FWPJPEGKVNLVRM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid?
The IUPAC name of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid (CID 57302754) is [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid.
What is the SMILES notation for [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid?
The canonical SMILES for [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid is CC(c1ccc(O)cc1)C(O)(O)c1c(O)cccc1P(=O)(O)O.
What is the InChIKey of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid?
The InChIKey is FWPJPEGKVNLVRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17O7P/c1-9(10-5-7-11(16)8-6-10)15(18,19)14-12(17)3-2-4-13(14)23(20,21)22/h2-9,16-19H,1H3,(H2,20,21,22).
What are the key properties of [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid?
[2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid has a molecular weight of 340.27 g/mol, XLogP of 0.84, 4 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1,1-dihydroxy-2-(4-hydroxyphenyl)propyl]-3-hydroxyphenyl]phosphonic acid is sourced from PubChem (CID 57302754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).