C25H36N2O2S — CID 57302870
(4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(4-hydroxyphenyl)-4,5-dihydro-2H-1,2-benzothiazepin-4-ol (PubChem CID 57302870) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(4-hydroxyphenyl)-4,5-dihydro-2H-1,2-benzothiazepin-4-ol.
| Compound Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(4-hydroxyphenyl)-4,5-dihydro-2H-1,2-benzothiazepin-4-ol |
|---|---|
| PubChem CID | 57302870 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (4R,5R)-3,3-dibutyl-7-(dimethylamino)-5-(4-hydroxyphenyl)-4,5-dihydro-2H-1,2-benzothiazepin-4-ol |
| SMILES | CCCCC1(CCCC)NSc2ccc(N(C)C)cc2[C@@H](c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C25H36N2O2S/c1-5-7-15-25(16-8-6-2)24(29)23(18-9-12-20(28)13-10-18)21-17-19(27(3)4)11-14-22(21)30-26-25/h9-14,17,23-24,26,28-29H,5-8,15-16H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | FGZUWGIMJJJFEB-DNQXCXABSA-N |
| XLogP | 5.68 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|