C10H18N2O6S2 — CID 57303203
N-[5-(methanesulfonamido)-3,7-dioxocyclooctyl]methanesulfonamide (PubChem CID 57303203) has the molecular formula C10H18N2O6S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[5-(methanesulfonamido)-3,7-dioxocyclooctyl]methanesulfonamide.
| Compound Name | N-[5-(methanesulfonamido)-3,7-dioxocyclooctyl]methanesulfonamide |
|---|---|
| PubChem CID | 57303203 |
| Molecular Formula | C10H18N2O6S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | N-[5-(methanesulfonamido)-3,7-dioxocyclooctyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CC(=O)CC(NS(C)(=O)=O)CC(=O)C1 |
| InChI | InChI=1S/C10H18N2O6S2/c1-19(15,16)11-7-3-9(13)5-8(6-10(14)4-7)12-20(2,17)18/h7-8,11-12H,3-6H2,1-2H3 |
| InChIKey | YHNCNZLLARJTBD-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |