About 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide
2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide (PubChem CID 57303254) has the molecular formula C5H5BrN4O2S
and a molecular weight of 265.09 g/mol. Its IUPAC name is 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide.
Molecular Properties
| Compound Name | 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide |
| PubChem CID | 57303254 |
| Molecular Formula | C5H5BrN4O2S |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 263.93 |
| IUPAC Name | 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide |
| SMILES | NC(=O)C(=NO)c1nc(N)sc1Br |
| InChI | InChI=1S/C5H5BrN4O2S/c6-3-1(9-5(8)13-3)2(10-12)4(7)11/h12H,(H2,7,11)(H2,8,9) |
| InChIKey | IJKCECJSWXBVSI-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide?
The IUPAC name of 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide (CID 57303254) is 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide.
What is the SMILES notation for 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide?
The canonical SMILES for 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide is NC(=O)C(=NO)c1nc(N)sc1Br.
What is the InChIKey of 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide?
The InChIKey is IJKCECJSWXBVSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN4O2S/c6-3-1(9-5(8)13-3)2(10-12)4(7)11/h12H,(H2,7,11)(H2,8,9).
What are the key properties of 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide?
2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide has a molecular weight of 265.09 g/mol, XLogP of 0.15, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-hydroxyiminoacetamide is sourced from PubChem (CID 57303254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).