About 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate
1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 573033) has the molecular formula C18H29BrO4
and a molecular weight of 389.33 g/mol. Its IUPAC name is 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 573033 |
| Molecular Formula | C18H29BrO4 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CCCCCCC(CBr)OC(=O)C12CCC(C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C18H29BrO4/c1-5-6-7-8-9-13(12-19)22-15(21)18-11-10-17(4,14(20)23-18)16(18,2)3/h13H,5-12H2,1-4H3 |
| InChIKey | BFZZTVTZTSSNKT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (CID 573033) is 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate is CCCCCCC(CBr)OC(=O)C12CCC(C)(C(=O)O1)C2(C)C.
What is the InChIKey of 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is BFZZTVTZTSSNKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29BrO4/c1-5-6-7-8-9-13(12-19)22-15(21)18-11-10-17(4,14(20)23-18)16(18,2)3/h13H,5-12H2,1-4H3.
What are the key properties of 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate?
1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 389.33 g/mol, XLogP of 4.39, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromooctan-2-yl 4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 573033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).