About 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene
1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene (PubChem CID 57303592) has the molecular formula C13H15Cl
and a molecular weight of 206.72 g/mol. Its IUPAC name is 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene.
Molecular Properties
| Compound Name | 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene |
| PubChem CID | 57303592 |
| Molecular Formula | C13H15Cl |
| Molecular Weight | 206.72 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene |
| SMILES | CC1(C)CCC=C1c1ccccc1Cl |
| InChI | InChI=1S/C13H15Cl/c1-13(2)9-5-7-11(13)10-6-3-4-8-12(10)14/h3-4,6-8H,5,9H2,1-2H3 |
| InChIKey | SNZQJMKGASSDBX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene?
The IUPAC name of 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene (CID 57303592) is 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene.
What is the SMILES notation for 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene?
The canonical SMILES for 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene is CC1(C)CCC=C1c1ccccc1Cl.
What is the InChIKey of 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene?
The InChIKey is SNZQJMKGASSDBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl/c1-13(2)9-5-7-11(13)10-6-3-4-8-12(10)14/h3-4,6-8H,5,9H2,1-2H3.
What are the key properties of 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene?
1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene has a molecular weight of 206.72 g/mol, XLogP of 4.54, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-(5,5-dimethylcyclopenten-1-yl)benzene is sourced from PubChem (CID 57303592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).