C26H41FO5 — CID 57303679
5-[(3aS,4R,5R,6aS)-4-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 57303679) has the molecular formula C26H41FO5 and a molecular weight of 452.61 g/mol. Its IUPAC name is 5-[(3aS,4R,5R,6aS)-4-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | 5-[(3aS,4R,5R,6aS)-4-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 57303679 |
| Molecular Formula | C26H41FO5 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 5-[(3aS,4R,5R,6aS)-4-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | CCCCC(F)C(=O)CC[C@@H]1[C@H]2CC(=CCCCC(=O)O)C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H41FO5/c1-2-3-9-22(27)23(28)13-12-20-21-16-18(8-4-5-10-25(29)30)15-19(21)17-24(20)32-26-11-6-7-14-31-26/h8,19-22,24,26H,2-7,9-17H2,1H3,(H,29,30)/t19-,20+,21-,22?,24+,26?/m0/s1 |
| InChIKey | DZJMBIDVLSIOQE-LDWDDBHWSA-N |
| XLogP | 6.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|