About hexane-1,3,4,6-tetramine
hexane-1,3,4,6-tetramine (PubChem CID 57303701) has the molecular formula C6H18N4
and a molecular weight of 146.24 g/mol. Its IUPAC name is hexane-1,3,4,6-tetramine.
Molecular Properties
| Compound Name | hexane-1,3,4,6-tetramine |
| PubChem CID | 57303701 |
| Molecular Formula | C6H18N4 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | hexane-1,3,4,6-tetramine |
| SMILES | NCCC(N)C(N)CCN |
| InChI | InChI=1S/C6H18N4/c7-3-1-5(9)6(10)2-4-8/h5-6H,1-4,7-10H2 |
| InChIKey | HHKIGDGJLABVRO-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hexane-1,3,4,6-tetramine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,3,4,6-tetramine?
The IUPAC name of hexane-1,3,4,6-tetramine (CID 57303701) is hexane-1,3,4,6-tetramine.
What is the SMILES notation for hexane-1,3,4,6-tetramine?
The canonical SMILES for hexane-1,3,4,6-tetramine is NCCC(N)C(N)CCN.
What is the InChIKey of hexane-1,3,4,6-tetramine?
The InChIKey is HHKIGDGJLABVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4/c7-3-1-5(9)6(10)2-4-8/h5-6H,1-4,7-10H2.
What are the key properties of hexane-1,3,4,6-tetramine?
hexane-1,3,4,6-tetramine has a molecular weight of 146.24 g/mol, XLogP of -1.66, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,3,4,6-tetramine is sourced from PubChem (CID 57303701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).