C15H21F3N4O — CID 57303707
2,2,2-trifluoro-N-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-8,10-dien-6-yl)butyl]acetamide (PubChem CID 57303707) has the molecular formula C15H21F3N4O and a molecular weight of 330.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-8,10-dien-6-yl)butyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-8,10-dien-6-yl)butyl]acetamide |
|---|---|
| PubChem CID | 57303707 |
| Molecular Formula | C15H21F3N4O |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(2,6,12-triazatricyclo[6.3.1.04,12]dodeca-8,10-dien-6-yl)butyl]acetamide |
| SMILES | O=C(NCCCCN1CC2=CC=CC3NCC(C1)N23)C(F)(F)F |
| InChI | InChI=1S/C15H21F3N4O/c16-15(17,18)14(23)19-6-1-2-7-21-9-11-4-3-5-13-20-8-12(10-21)22(11)13/h3-5,12-13,20H,1-2,6-10H2,(H,19,23) |
| InChIKey | VFYOJSPCZMBNEA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|