C16H27N2O6S+ — CID 57303754
(1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-(propylcarbamoyloxy)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57303754) has the molecular formula C16H27N2O6S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-(propylcarbamoyloxy)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-(propylcarbamoyloxy)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57303754 |
| Molecular Formula | C16H27N2O6S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (1R,2R,4R)-1-(3-acetylsulfanyl-2-methylpropanoyl)-2-methyl-4-(propylcarbamoyloxy)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCCNC(=O)O[C@@H]1C[C@@H](C)[N@@+](C(=O)O)(C(=O)C(C)CSC(C)=O)C1 |
| InChI | InChI=1S/C16H26N2O6S/c1-5-6-17-15(21)24-13-7-11(3)18(8-13,16(22)23)14(20)10(2)9-25-12(4)19/h10-11,13H,5-9H2,1-4H3,(H-,17,21,22,23)/p+1/t10?,11-,13-,18-/m1/s1 |
| InChIKey | PZELZJJYDCCWKE-ZMHDLKMESA-O |
| XLogP | 2.22 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|