C26H34FNO6P+ — CID 57303888
(1R,2R,4R)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57303888) has the molecular formula C26H34FNO6P+ and a molecular weight of 506.53 g/mol. Its IUPAC name is (1R,2R,4R)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57303888 |
| Molecular Formula | C26H34FNO6P+ |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (1R,2R,4R)-1-[2-[ethoxy(4-phenylbutyl)phosphoryl]acetyl]-4-(4-fluorophenoxy)-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CCOP(=O)(CCCCc1ccccc1)CC(=O)[N@@+]1(C(=O)O)C[C@H](Oc2ccc(F)cc2)C[C@H]1C |
| InChI | InChI=1S/C26H33FNO6P/c1-3-33-35(32,16-8-7-11-21-9-5-4-6-10-21)19-25(29)28(26(30)31)18-24(17-20(28)2)34-23-14-12-22(27)13-15-23/h4-6,9-10,12-15,20,24H,3,7-8,11,16-19H2,1-2H3/p+1/t20-,24-,28-,35?/m1/s1 |
| InChIKey | KLJUVLACTXFVGI-YTBQBPMQSA-O |
| XLogP | 5.72 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|