C11H9FN2O3 — CID 573040
5-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 573040) has the molecular formula C11H9FN2O3 and a molecular weight of 236.20 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 573040 |
| Molecular Formula | C11H9FN2O3 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(Cc2ccc(F)cc2)C(=O)N1 |
| InChI | InChI=1S/C11H9FN2O3/c12-7-3-1-6(2-4-7)5-8-9(15)13-11(17)14-10(8)16/h1-4,8H,5H2,(H2,13,14,15,16,17) |
| InChIKey | GMRGYPUZVJJACN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|