C22H17F2N3O2 — CID 573043
1,2-bis[(2-fluorophenyl)methyl]-4-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 573043) has the molecular formula C22H17F2N3O2 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1,2-bis[(2-fluorophenyl)methyl]-4-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1,2-bis[(2-fluorophenyl)methyl]-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 573043 |
| Molecular Formula | C22H17F2N3O2 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1,2-bis[(2-fluorophenyl)methyl]-4-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n(Cc2ccccc2F)n1Cc1ccccc1F |
| InChI | InChI=1S/C22H17F2N3O2/c23-19-12-6-4-8-16(19)14-25-21(28)27(18-10-2-1-3-11-18)22(29)26(25)15-17-9-5-7-13-20(17)24/h1-13H,14-15H2 |
| InChIKey | NBYJKLLIDDDJJJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |