About 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid
5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid (PubChem CID 57305027) has the molecular formula C16H13NO3
and a molecular weight of 267.28 g/mol. Its IUPAC name is 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 57305027 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=CC(c2ccccc2)(c2ccccc2)ON1 |
| InChI | InChI=1S/C16H13NO3/c18-15(19)14-11-16(20-17-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,17H,(H,18,19) |
| InChIKey | PAESGJKTBQWSFU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid (CID 57305027) is 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid is O=C(O)C1=CC(c2ccccc2)(c2ccccc2)ON1.
What is the InChIKey of 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid?
The InChIKey is PAESGJKTBQWSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO3/c18-15(19)14-11-16(20-17-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,17H,(H,18,19).
What are the key properties of 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid?
5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid has a molecular weight of 267.28 g/mol, XLogP of 2.43, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-diphenyl-2H-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 57305027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).