C38H38F6N2O6 — CID 57305208
bis[1-amino-2-benzyl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate (PubChem CID 57305208) has the molecular formula C38H38F6N2O6 and a molecular weight of 732.72 g/mol. Its IUPAC name is bis[1-amino-2-benzyl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate.
| Compound Name | bis[1-amino-2-benzyl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate |
|---|---|
| PubChem CID | 57305208 |
| Molecular Formula | C38H38F6N2O6 |
| Molecular Weight | 732.72 g/mol |
| Exact Mass | 732.26 |
| IUPAC Name | bis[1-amino-2-benzyl-3-[4-(trifluoromethyl)phenoxy]butyl] oxalate |
| SMILES | CC(Oc1ccc(C(F)(F)F)cc1)C(Cc1ccccc1)C(N)OC(=O)C(=O)OC(N)C(Cc1ccccc1)C(C)Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H38F6N2O6/c1-23(49-29-17-13-27(14-18-29)37(39,40)41)31(21-25-9-5-3-6-10-25)33(45)51-35(47)36(48)52-34(46)32(22-26-11-7-4-8-12-26)24(2)50-30-19-15-28(16-20-30)38(42,43)44/h3-20,23-24,31-34H,21-22,45-46H2,1-2H3 |
| InChIKey | NVLZZWIUGJPEEW-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.72 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|