About 3-phenyl-2H-1,3,4-thiadiazole-2-thiol
3-phenyl-2H-1,3,4-thiadiazole-2-thiol (PubChem CID 57305229) has the molecular formula C8H8N2S2
and a molecular weight of 196.30 g/mol. Its IUPAC name is 3-phenyl-2H-1,3,4-thiadiazole-2-thiol.
Molecular Properties
| Compound Name | 3-phenyl-2H-1,3,4-thiadiazole-2-thiol |
| PubChem CID | 57305229 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 3-phenyl-2H-1,3,4-thiadiazole-2-thiol |
| SMILES | SC1SC=NN1c1ccccc1 |
| InChI | InChI=1S/C8H8N2S2/c11-8-10(9-6-12-8)7-4-2-1-3-5-7/h1-6,8,11H |
| InChIKey | HFCFKJFXMXBYFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2H-1,3,4-thiadiazole-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2H-1,3,4-thiadiazole-2-thiol?
The IUPAC name of 3-phenyl-2H-1,3,4-thiadiazole-2-thiol (CID 57305229) is 3-phenyl-2H-1,3,4-thiadiazole-2-thiol.
What is the SMILES notation for 3-phenyl-2H-1,3,4-thiadiazole-2-thiol?
The canonical SMILES for 3-phenyl-2H-1,3,4-thiadiazole-2-thiol is SC1SC=NN1c1ccccc1.
What is the InChIKey of 3-phenyl-2H-1,3,4-thiadiazole-2-thiol?
The InChIKey is HFCFKJFXMXBYFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S2/c11-8-10(9-6-12-8)7-4-2-1-3-5-7/h1-6,8,11H.
What are the key properties of 3-phenyl-2H-1,3,4-thiadiazole-2-thiol?
3-phenyl-2H-1,3,4-thiadiazole-2-thiol has a molecular weight of 196.30 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2H-1,3,4-thiadiazole-2-thiol is sourced from PubChem (CID 57305229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).