C19H27BrO3 — CID 57305386
(3R,5R,8R,9S,10S,13S,14S,16R)-16-bromo-3-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione (PubChem CID 57305386) has the molecular formula C19H27BrO3 and a molecular weight of 383.33 g/mol. Its IUPAC name is (3R,5R,8R,9S,10S,13S,14S,16R)-16-bromo-3-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | (3R,5R,8R,9S,10S,13S,14S,16R)-16-bromo-3-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 57305386 |
| Molecular Formula | C19H27BrO3 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (3R,5R,8R,9S,10S,13S,14S,16R)-16-bromo-3-hydroxy-10,13-dimethyl-2,3,4,5,6,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
| SMILES | C[C@]12CC[C@@H](O)C[C@@H]1CC(=O)[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@H](Br)C[C@@H]12 |
| InChI | InChI=1S/C19H27BrO3/c1-18-5-3-11(21)7-10(18)8-15(22)16-12(18)4-6-19(2)13(16)9-14(20)17(19)23/h10-14,16,21H,3-9H2,1-2H3/t10-,11-,12+,13+,14-,16-,18+,19+/m1/s1 |
| InChIKey | QWNHQOPJAGQFJF-FYRRREDOSA-N |
| XLogP | 3.51 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|