About [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate
[(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate (PubChem CID 57305404) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate.
Molecular Properties
| Compound Name | [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate |
| PubChem CID | 57305404 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CC(=O)N[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C15H25NO3/c1-2-6-15(18)19-13-10-14(17)16-12(13)9-11-7-4-3-5-8-11/h11-13H,2-10H2,1H3,(H,16,17)/t12-,13-/m0/s1 |
| InChIKey | BCZULNXTDSLKTR-STQMWFEESA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate?
The IUPAC name of [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate (CID 57305404) is [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate.
What is the SMILES notation for [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate?
The canonical SMILES for [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate is CCCC(=O)O[C@H]1CC(=O)N[C@H]1CC1CCCCC1.
What is the InChIKey of [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate?
The InChIKey is BCZULNXTDSLKTR-STQMWFEESA-N. The full InChI is InChI=1S/C15H25NO3/c1-2-6-15(18)19-13-10-14(17)16-12(13)9-11-7-4-3-5-8-11/h11-13H,2-10H2,1H3,(H,16,17)/t12-,13-/m0/s1.
What are the key properties of [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate?
[(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate has a molecular weight of 267.37 g/mol, XLogP of 2.56, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-2-(cyclohexylmethyl)-5-oxopyrrolidin-3-yl] butanoate is sourced from PubChem (CID 57305404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).