About [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone
[(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone (PubChem CID 57305562) has the molecular formula C9H8O2
and a molecular weight of 148.16 g/mol. Its IUPAC name is [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone.
Molecular Properties
| Compound Name | [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone |
| PubChem CID | 57305562 |
| Molecular Formula | C9H8O2 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone |
| SMILES | O=C=C1CC2C=CC=C[C@@H]2O1 |
| InChI | InChI=1S/C9H8O2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,7,9H,5H2/t7?,9-/m0/s1 |
| InChIKey | HZEPTWANNUXIDO-NETXQHHPSA-N |
| XLogP | 1.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone?
The IUPAC name of [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone (CID 57305562) is [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone.
What is the SMILES notation for [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone?
The canonical SMILES for [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone is O=C=C1CC2C=CC=C[C@@H]2O1.
What is the InChIKey of [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone?
The InChIKey is HZEPTWANNUXIDO-NETXQHHPSA-N. The full InChI is InChI=1S/C9H8O2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,7,9H,5H2/t7?,9-/m0/s1.
What are the key properties of [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone?
[(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone has a molecular weight of 148.16 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(7aS)-3a,7a-dihydro-3H-1-benzofuran-2-ylidene]methanone is sourced from PubChem (CID 57305562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).