C24H31NO2 — CID 57305852
(4bS,8aR)-4b-[2-(2-phenylethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol (PubChem CID 57305852) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (4bS,8aR)-4b-[2-(2-phenylethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol.
| Compound Name | (4bS,8aR)-4b-[2-(2-phenylethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol |
|---|---|
| PubChem CID | 57305852 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (4bS,8aR)-4b-[2-(2-phenylethylamino)ethyl]-5,6,7,8,9,10-hexahydrophenanthrene-3,8a-diol |
| SMILES | Oc1ccc2c(c1)[C@@]1(CCNCCc3ccccc3)CCCC[C@@]1(O)CC2 |
| InChI | InChI=1S/C24H31NO2/c26-21-9-8-20-10-14-24(27)13-5-4-12-23(24,22(20)18-21)15-17-25-16-11-19-6-2-1-3-7-19/h1-3,6-9,18,25-27H,4-5,10-17H2/t23-,24+/m0/s1 |
| InChIKey | TZVBZNRTERQGAJ-BJKOFHAPSA-N |
| XLogP | 4.10 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|