C37H34N6O4 — CID 57306145
6-methyl-2-[2-[3-[2-(6-methyl-1,3-dioxopyrrolo[3,4-c]carbazol-2-yl)ethylamino]propylamino]ethyl]pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 57306145) has the molecular formula C37H34N6O4 and a molecular weight of 626.72 g/mol. Its IUPAC name is 6-methyl-2-[2-[3-[2-(6-methyl-1,3-dioxopyrrolo[3,4-c]carbazol-2-yl)ethylamino]propylamino]ethyl]pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 6-methyl-2-[2-[3-[2-(6-methyl-1,3-dioxopyrrolo[3,4-c]carbazol-2-yl)ethylamino]propylamino]ethyl]pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 57306145 |
| Molecular Formula | C37H34N6O4 |
| Molecular Weight | 626.72 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 6-methyl-2-[2-[3-[2-(6-methyl-1,3-dioxopyrrolo[3,4-c]carbazol-2-yl)ethylamino]propylamino]ethyl]pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | Cn1c2ccccc2c2c3c(ccc21)C(=O)N(CCNCCCNCCN1C(=O)c2ccc4c(c2C1=O)c1ccccc1n4C)C3=O |
| InChI | InChI=1S/C37H34N6O4/c1-40-26-10-5-3-8-22(26)30-28(40)14-12-24-32(30)36(46)42(34(24)44)20-18-38-16-7-17-39-19-21-43-35(45)25-13-15-29-31(33(25)37(43)47)23-9-4-6-11-27(23)41(29)2/h3-6,8-15,38-39H,7,16-21H2,1-2H3 |
| InChIKey | JWQZGMYBIGGYTO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.72 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|