C28H38N4O7S2 — CID 57306243
N'-[[4-[[3-(dimethylaminomethylideneamino)sulfonyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]methoxymethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-N,N-dimethylmethanimidamide (PubChem CID 57306243) has the molecular formula C28H38N4O7S2 and a molecular weight of 606.77 g/mol. Its IUPAC name is N'-[[4-[[3-(dimethylaminomethylideneamino)sulfonyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]methoxymethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[[4-[[3-(dimethylaminomethylideneamino)sulfonyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]methoxymethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 57306243 |
| Molecular Formula | C28H38N4O7S2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | N'-[[4-[[3-(dimethylaminomethylideneamino)sulfonyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl]methoxymethyl]-3-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl]sulfonyl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NS(=O)(=O)c1cc2c(c(COCc3c(O)c(S(=O)(=O)N=CN(C)C)cc4c3CCCC4)c1O)CCCC2 |
| InChI | InChI=1S/C28H38N4O7S2/c1-31(2)17-29-40(35,36)25-13-19-9-5-7-11-21(19)23(27(25)33)15-39-16-24-22-12-8-6-10-20(22)14-26(28(24)34)41(37,38)30-18-32(3)4/h13-14,17-18,33-34H,5-12,15-16H2,1-4H3 |
| InChIKey | QUFVFNJHGXIQTK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 149.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|