About CID 57306391
CID 57306391 (PubChem CID 57306391) has the molecular formula C8H13Si
and a molecular weight of 137.28 g/mol.
Molecular Properties
| Compound Name | CID 57306391 |
| PubChem CID | 57306391 |
| Molecular Formula | C8H13Si |
| Molecular Weight | 137.28 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | — |
| SMILES | CC1=[Si]C(C)C(C)=C1C |
| InChI | InChI=1S/C8H13Si/c1-5-6(2)8(4)9-7(5)3/h7H,1-4H3 |
| InChIKey | OCFBOKONHMBHGO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57306391 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57306391?
The IUPAC name of CID 57306391 (CID 57306391) is not available.
What is the SMILES notation for CID 57306391?
The canonical SMILES for CID 57306391 is CC1=[Si]C(C)C(C)=C1C.
What is the InChIKey of CID 57306391?
The InChIKey is OCFBOKONHMBHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13Si/c1-5-6(2)8(4)9-7(5)3/h7H,1-4H3.
What are the key properties of CID 57306391?
CID 57306391 has a molecular weight of 137.28 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57306391 is sourced from PubChem (CID 57306391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).